CAS 3365-82-0 appears in our catalog under these names: 4'–bromobiphenyl–4–amine, 4'-Bromo-[1,1'-biphenyl]-4-amine, 97%, 4-Amino-4'-bromobiphenyl, 95%. Offered by: GLPBio, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
4-(4-bromophenyl)aniline (CAS 3365-82-0) is a chemical compound with the molecular formula C12H10BrN and a molecular weight of 248.12 g/mol. IUPAC name: 4-(4-bromophenyl)aniline. InChIKey: YGPBKHKHMVGUFO-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN |
|---|---|
| Molecular weight | 248.12 g/mol |
| IUPAC name | 4-(4-bromophenyl)aniline |
| InChIKey | YGPBKHKHMVGUFO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)Br)N |
Computed by PubChem (NCBI)