Products 337362-21-7
CAS 337362-21-7 appears in our catalog under these names: Methyl 5-cyano-2-fluorobenzoate, 5–Cyano–2–Fluorobenzoic Acid Methyl Ester, Methyl 5-cyano-2-fluorobenzoate 98%, Methyl 5-cyano-2-fluorobenzoate, 98%, 98%, METHYL 5-CYANO-2-FLUOROBENZOATE, 95%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 25g, 2,5g, 5g, 100g.
Methyl 5-cyano-2-fluorobenzoate (CAS 337362-21-7) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: methyl 5-cyano-2-fluorobenzoate. InChIKey: ZIQLDZYJUIPASJ-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | methyl 5-cyano-2-fluorobenzoate |
| InChIKey | ZIQLDZYJUIPASJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)C#N)F |
Computed by PubChem (NCBI)