Products 341018-58-4
CAS 341018-58-4 is the registry number for N-(2-Cyanophenyl)-2-hydroxybenzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-cyanophenyl)-2-hydroxybenzamide (CAS 341018-58-4) is a chemical compound with the molecular formula C14H10N2O2 and a molecular weight of 238.24 g/mol. IUPAC name: N-(2-cyanophenyl)-2-hydroxybenzamide. InChIKey: HYTJGTUZXKLGLF-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O2 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | N-(2-cyanophenyl)-2-hydroxybenzamide |
| InChIKey | HYTJGTUZXKLGLF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)NC(=O)C2=CC=CC=C2O |
Computed by PubChem (NCBI)