Products 34132-07-5
CAS 34132-07-5 appears in our catalog under these names: 8-(Aminomethyl)cubane-1-carboxylic acid hydrochloride, 98%, (2R,3R,4S,5S)-4-(Aminomethyl)cubane-1-carboxylic acid hydrochloride, 98%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 100mg.
4-(aminomethyl)cubane-1-carboxylic acid;hydrochloride (CAS 34132-07-5) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: 4-(aminomethyl)cubane-1-carboxylic acid;hydrochloride. InChIKey: FLOSYVFCPMJPKL-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 4-(aminomethyl)cubane-1-carboxylic acid;hydrochloride |
| InChIKey | FLOSYVFCPMJPKL-UHFFFAOYSA-N |
| SMILES | C(C12C3C4C1C5C2C3C45C(=O)O)N.Cl |
Computed by PubChem (NCBI)