CAS 34184-93-5 appears in our catalog under these names: 2-Ethoxy-4-[(1e)-(hydroxyimino)methyl]phenol, 95%, 2-Ethoxy-4-((hydroxyimino)methyl)phenol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-ethoxy-4-[(E)-hydroxyiminomethyl]phenol (CAS 34184-93-5) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 2-ethoxy-4-[(E)-hydroxyiminomethyl]phenol. InChIKey: AZAMLLOELYKGDG-UXBLZVDNSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 2-ethoxy-4-[(E)-hydroxyiminomethyl]phenol |
| InChIKey | AZAMLLOELYKGDG-UXBLZVDNSA-N |
| SMILES | CCOC1=C(C=CC(=C1)/C=N/O)O |
Computed by PubChem (NCBI)