CAS 34252-44-3 appears in our catalog under these names: 2-Methylindazole-3-carboxylic acid, 2-Methylindazole-3-carboxylic Acid, >95% (HPLC), 2-Methyl-2H-indazole-3-carboxylic Acid, 2-Methyl-2H-indazole-3-carboxylic acid, 97% , 2-Methyl-2H-indazole-3-carboxylic acid 95%. Offered by: Biosynth, TRC, Mikromol, Thermo Scientific, Ambeed. Available pack sizes: 10g, 100mg, 500mg, 50mg, 250MG, 1g, 5g, 25g.
2-methylindazole-3-carboxylic acid (CAS 34252-44-3) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 2-methylindazole-3-carboxylic acid. InChIKey: ABRISPFTOZIXMP-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 2-methylindazole-3-carboxylic acid |
| InChIKey | ABRISPFTOZIXMP-UHFFFAOYSA-N |
| SMILES | CN1C(=C2C=CC=CC2=N1)C(=O)O |
Computed by PubChem (NCBI)