Products 342618-61-5
CAS 342618-61-5 is the registry number for 1,1-Dioxo-2,3-dihydro-1λ6-benzothiophene-6-carbonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg.
1,1-dioxo-2,3-dihydro-1-benzothiophene-6-carbonitrile (CAS 342618-61-5) is a chemical compound with the molecular formula C9H7NO2S and a molecular weight of 193.22 g/mol. IUPAC name: 1,1-dioxo-2,3-dihydro-1-benzothiophene-6-carbonitrile. InChIKey: ZSAXGEHRUIVJEN-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | 1,1-dioxo-2,3-dihydro-1-benzothiophene-6-carbonitrile |
| InChIKey | ZSAXGEHRUIVJEN-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C2=C1C=CC(=C2)C#N |
Computed by PubChem (NCBI)