CAS 343773-15-9 is the registry number for Proparacaine Impurity 17. Offered by: Chemat Brand. Available pack sizes: on request.
Propyl 3-amino-4-chlorobenzoate (CAS 343773-15-9) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: propyl 3-amino-4-chlorobenzoate. InChIKey: ZLJVVDUAIWCUKZ-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | propyl 3-amino-4-chlorobenzoate |
| InChIKey | ZLJVVDUAIWCUKZ-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)C1=CC(=C(C=C1)Cl)N |
Computed by PubChem (NCBI)