CAS 343788-75-0 is the registry number for 6,7-Dihydro-1h-[1,4]dioxino[2,3-f]benzimidazole, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
6,7-dihydro-1H-[1,4]dioxino[2,3-f]benzimidazole (CAS 343788-75-0) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 6,7-dihydro-1H-[1,4]dioxino[2,3-f]benzimidazole. InChIKey: WERQRLHRZGPICN-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 6,7-dihydro-1H-[1,4]dioxino[2,3-f]benzimidazole |
| InChIKey | WERQRLHRZGPICN-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C3C(=C2)N=CN3 |
Computed by PubChem (NCBI)