CAS 34551-17-2 appears in our catalog under these names: 5-Chloro-N-methyl-2-benzothiazolamine, 5-Chloro-N-methyl-1,3-benzothiazol-2-amine. Offered by: TRC, Biosynth. Available pack sizes: 1g, 100mg.
5-chloro-N-methyl-1,3-benzothiazol-2-amine (CAS 34551-17-2) is a chemical compound with the molecular formula C8H7ClN2S and a molecular weight of 198.67 g/mol. IUPAC name: 5-chloro-N-methyl-1,3-benzothiazol-2-amine. InChIKey: ZIYKFNBOSWDWSJ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2S |
|---|---|
| Molecular weight | 198.67 g/mol |
| IUPAC name | 5-chloro-N-methyl-1,3-benzothiazol-2-amine |
| InChIKey | ZIYKFNBOSWDWSJ-UHFFFAOYSA-N |
| SMILES | CNC1=NC2=C(S1)C=CC(=C2)Cl |
Computed by PubChem (NCBI)