CAS 34551-18-3 appears in our catalog under these names: 7-Chloro-N-methyl-2-benzothiazolamine, 7-Chloro-N-methylbenzo(d)thiazol-2-amine, 97%, 7-Chloro-N-methyl-1,3-benzothiazol-2-amine. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 2,5g, 1g, 0,5g, 50mg.
7-chloro-N-methyl-1,3-benzothiazol-2-amine (CAS 34551-18-3) is a chemical compound with the molecular formula C8H7ClN2S and a molecular weight of 198.67 g/mol. IUPAC name: 7-chloro-N-methyl-1,3-benzothiazol-2-amine. InChIKey: QTCLZYBMLMPNOF-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2S |
|---|---|
| Molecular weight | 198.67 g/mol |
| IUPAC name | 7-chloro-N-methyl-1,3-benzothiazol-2-amine |
| InChIKey | QTCLZYBMLMPNOF-UHFFFAOYSA-N |
| SMILES | CNC1=NC2=C(S1)C(=CC=C2)Cl |
Computed by PubChem (NCBI)