Products 34626-06-7
CAS 34626-06-7 is the registry number for 2-(pyridin-4-yl)-1H-imidazole-5-carboxylic acid, 98%. Offered by: Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-pyridin-4-yl-1H-imidazole-5-carboxylic acid (CAS 34626-06-7) is a chemical compound with the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. IUPAC name: 2-pyridin-4-yl-1H-imidazole-5-carboxylic acid. InChIKey: IKHNTCURSBQOJB-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 2-pyridin-4-yl-1H-imidazole-5-carboxylic acid |
| InChIKey | IKHNTCURSBQOJB-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=NC=C(N2)C(=O)O |
Computed by PubChem (NCBI)