CAS 34658-33-8 appears in our catalog under these names: 5-(3,4-Dichlorophenyl)pentanoic acid, 95%, 5-(3,4-Dichlorophenyl)pentanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
5-(3,4-dichlorophenyl)pentanoic acid (CAS 34658-33-8) is a chemical compound with the molecular formula C11H12Cl2O2 and a molecular weight of 247.11 g/mol. IUPAC name: 5-(3,4-dichlorophenyl)pentanoic acid. InChIKey: RHSWIBGNIWRQNH-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O2 |
|---|---|
| Molecular weight | 247.11 g/mol |
| IUPAC name | 5-(3,4-dichlorophenyl)pentanoic acid |
| InChIKey | RHSWIBGNIWRQNH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CCCCC(=O)O)Cl)Cl |
Computed by PubChem (NCBI)