Products 347187-18-2
CAS 347187-18-2 appears in our catalog under these names: 5-(2-Fluorophenyl)oxazole-4-carboxylic acid, 96%, 5-(2-Fluorophenyl)oxazole-4-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 1g, 50mg, 100mg, 500mg.
5-(2-fluorophenyl)-1,3-oxazole-4-carboxylic acid (CAS 347187-18-2) is a chemical compound with the molecular formula C10H6FNO3 and a molecular weight of 207.16 g/mol. IUPAC name: 5-(2-fluorophenyl)-1,3-oxazole-4-carboxylic acid. InChIKey: COYYCXFHTJQGGF-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO3 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | 5-(2-fluorophenyl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | COYYCXFHTJQGGF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=C(N=CO2)C(=O)O)F |
Computed by PubChem (NCBI)