CAS 347840-12-4 is the registry number for 1-Chloro-2,4-dinitrobenzene-d3, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.
1-chloro-2,3,5-trideuterio-4,6-dinitrobenzene (CAS 347840-12-4) is a chemical compound with the molecular formula C6H3ClN2O4 and a molecular weight of 205.57 g/mol. IUPAC name: 1-chloro-2,3,5-trideuterio-4,6-dinitrobenzene. InChIKey: VYZAHLCBVHPDDF-CBYSEHNBSA-N.
| Molecular formula | C6H3ClN2O4 |
|---|---|
| Molecular weight | 205.57 g/mol |
| IUPAC name | 1-chloro-2,3,5-trideuterio-4,6-dinitrobenzene |
| InChIKey | VYZAHLCBVHPDDF-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[N+](=O)[O-])[2H])[N+](=O)[O-])Cl)[2H] |
Computed by PubChem (NCBI)