Products 347840-12-4

CAS 347840-12-4 is the registry number for 1-Chloro-2,4-dinitrobenzene-d3, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.

Structural formula: {0} (CAS {1})

1-chloro-2,3,5-trideuterio-4,6-dinitrobenzene (CAS 347840-12-4) is a chemical compound with the molecular formula C6H3ClN2O4 and a molecular weight of 205.57 g/mol. IUPAC name: 1-chloro-2,3,5-trideuterio-4,6-dinitrobenzene. InChIKey: VYZAHLCBVHPDDF-CBYSEHNBSA-N.

Identity
Molecular formulaC6H3ClN2O4
Molecular weight205.57 g/mol
IUPAC name1-chloro-2,3,5-trideuterio-4,6-dinitrobenzene
InChIKeyVYZAHLCBVHPDDF-CBYSEHNBSA-N
SMILES[2H]C1=C(C(=C(C(=C1[N+](=O)[O-])[2H])[N+](=O)[O-])Cl)[2H]

Computed by PubChem (NCBI)