CAS 3484-10-4 appears in our catalog under these names: 2-Methyl-4-nitroindole 97%, 2-Methyl-4-Nitroindole, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-methyl-4-nitro-1H-indole (CAS 3484-10-4) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 2-methyl-4-nitro-1H-indole. InChIKey: HCISKOUSZIJNET-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 2-methyl-4-nitro-1H-indole |
| InChIKey | HCISKOUSZIJNET-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1)C=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)