CAS 349553-95-3 appears in our catalog under these names: Dicamba-d3, >95% (HPLC), Dicamba D3 (methoxy D3), Dicamba D3 (methoxy D3) 100 µg/mL in Acetone, 3,6-Dichloro-2-methoxy-d3-benzoic Acid, 99 atom % D, min 98% Chemical Purity, Dicamba–d3. Offered by: TRC, Dr. Ehrenstorfer, CDN, GLPBio, Sigma-Aldrich. Available pack sizes: 1mg, 10mg, 1ml, 0,01g, 0,005g, 5mg, 5 mg, 1x10mg.
3,6-dichloro-2-(trideuteriomethoxy)benzoic acid (CAS 349553-95-3) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 224.05 g/mol. IUPAC name: 3,6-dichloro-2-(trideuteriomethoxy)benzoic acid. InChIKey: IWEDIXLBFLAXBO-FIBGUPNXSA-N.
| Molecular formula | C8H6Cl2O3 |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 3,6-dichloro-2-(trideuteriomethoxy)benzoic acid |
| InChIKey | IWEDIXLBFLAXBO-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)