CAS 3507-47-9 is the registry number for 4-Methylbenzo(d)thiazole-2-carboxylic acid, 98+%. Offered by: AmBeed. Available pack sizes: 5g, 250mg, 1g.
4-methyl-1,3-benzothiazole-2-carboxylic acid (CAS 3507-47-9) is a chemical compound with the molecular formula C9H7NO2S and a molecular weight of 193.22 g/mol. IUPAC name: 4-methyl-1,3-benzothiazole-2-carboxylic acid. InChIKey: OGZSALMHZWEKSS-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | 4-methyl-1,3-benzothiazole-2-carboxylic acid |
| InChIKey | OGZSALMHZWEKSS-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)SC(=N2)C(=O)O |
Computed by PubChem (NCBI)