CAS 350820-03-0 appears in our catalog under these names: 17Beta-Dihydro Equilin-16,16,17-d3, >95% (HPLC), 17beta-Dihydroequilin-16,16,17-d3, 98 atom % D, min 97% Chemical Purity, β-Dihydroequilin-d3. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 1mg, 0,01g, 0,005g, 10 mg, 1 mg, 2.5 mg, 5 mg.
(9S,13S,14S,17S)-16,16,17-trideuterio-13-methyl-6,9,11,12,14,15-hexahydrocyclopenta[a]phenanthrene-3,17-diol (CAS 350820-03-0) is a chemical compound with the molecular formula C18H22O2 and a molecular weight of 273.4 g/mol. IUPAC name: (9S,13S,14S,17S)-16,16,17-trideuterio-13-methyl-6,9,11,12,14,15-hexahydrocyclopenta[a]phenanthrene-3,17-diol. InChIKey: NLLMJANWPUQQTA-XPOHSFSVSA-N.
| Molecular formula | C18H22O2 |
|---|---|
| Molecular weight | 273.4 g/mol |
| IUPAC name | (9S,13S,14S,17S)-16,16,17-trideuterio-13-methyl-6,9,11,12,14,15-hexahydrocyclopenta[a]phenanthrene-3,17-diol |
| InChIKey | NLLMJANWPUQQTA-XPOHSFSVSA-N |
| SMILES | [2H][C@]1([C@]2(CC[C@H]3C(=CCC4=C3C=CC(=C4)O)[C@@H]2CC1([2H])[2H])C)O |
Computed by PubChem (NCBI)