Products 35115-72-1

CAS 35115-72-1 is the registry number for 2-Amino-2-(3,4-dihydroxybenzyl)butanoic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

2-amino-2-[(3,4-dihydroxyphenyl)methyl]butanoic acid (CAS 35115-72-1) is a chemical compound with the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. IUPAC name: 2-amino-2-[(3,4-dihydroxyphenyl)methyl]butanoic acid. InChIKey: BIKJABALNOHOLC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15NO4
Molecular weight225.24 g/mol
IUPAC name2-amino-2-[(3,4-dihydroxyphenyl)methyl]butanoic acid
InChIKeyBIKJABALNOHOLC-UHFFFAOYSA-N
SMILESCCC(CC1=CC(=C(C=C1)O)O)(C(=O)O)N

Computed by PubChem (NCBI)