CAS 884-81-1 is the registry number for rac alpha-Ethyl DOPA. Offered by: TRC. Available pack sizes: 250mg.
2-amino-2-[(3,4-dihydroxyphenyl)methyl]butanoic acid (CAS 884-81-1) is a chemical compound with the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. IUPAC name: 2-amino-2-[(3,4-dihydroxyphenyl)methyl]butanoic acid. InChIKey: BIKJABALNOHOLC-UHFFFAOYSA-N.
| Molecular formula | C11H15NO4 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | 2-amino-2-[(3,4-dihydroxyphenyl)methyl]butanoic acid |
| InChIKey | BIKJABALNOHOLC-UHFFFAOYSA-N |
| SMILES | CCC(CC1=CC(=C(C=C1)O)O)(C(=O)O)N |
Computed by PubChem (NCBI)