Products 884-81-1

CAS 884-81-1 is the registry number for rac alpha-Ethyl DOPA. Offered by: TRC. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

2-amino-2-[(3,4-dihydroxyphenyl)methyl]butanoic acid (CAS 884-81-1) is a chemical compound with the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. IUPAC name: 2-amino-2-[(3,4-dihydroxyphenyl)methyl]butanoic acid. InChIKey: BIKJABALNOHOLC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15NO4
Molecular weight225.24 g/mol
IUPAC name2-amino-2-[(3,4-dihydroxyphenyl)methyl]butanoic acid
InChIKeyBIKJABALNOHOLC-UHFFFAOYSA-N
SMILESCCC(CC1=CC(=C(C=C1)O)O)(C(=O)O)N

Computed by PubChem (NCBI)