CAS 351410-41-8 is the registry number for Methyl 2-methoxy-5-methylpyridine-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 2-methoxy-5-methylpyridine-3-carboxylate (CAS 351410-41-8) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: methyl 2-methoxy-5-methylpyridine-3-carboxylate. InChIKey: FWBSCYBDOKZJGQ-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | methyl 2-methoxy-5-methylpyridine-3-carboxylate |
| InChIKey | FWBSCYBDOKZJGQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)OC)C(=O)OC |
Computed by PubChem (NCBI)