CAS 35241-09-9 is the registry number for 6,7,8-Trimethoxy-2-methyl-4H-benzo[d][1,3]oxazin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,7,8-trimethoxy-2-methyl-3,1-benzoxazin-4-one (CAS 35241-09-9) is a chemical compound with the molecular formula C12H13NO5 and a molecular weight of 251.23 g/mol. IUPAC name: 6,7,8-trimethoxy-2-methyl-3,1-benzoxazin-4-one. InChIKey: GKNFROIIDASAMP-UHFFFAOYSA-N.
| Molecular formula | C12H13NO5 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | 6,7,8-trimethoxy-2-methyl-3,1-benzoxazin-4-one |
| InChIKey | GKNFROIIDASAMP-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=C(C=C2C(=O)O1)OC)OC)OC |
Computed by PubChem (NCBI)