CAS 35246-87-8 is the registry number for 5,7-Dichloro-3-hydrazinylidene-2,3-dihydro-1H-indol-2-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5,7-dichloro-3-diazenyl-1H-indol-2-ol (CAS 35246-87-8) is a chemical compound with the molecular formula C8H5Cl2N3O and a molecular weight of 230.05 g/mol. IUPAC name: 5,7-dichloro-3-diazenyl-1H-indol-2-ol. InChIKey: NRRBDRCZCPYBBY-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3O |
|---|---|
| Molecular weight | 230.05 g/mol |
| IUPAC name | 5,7-dichloro-3-diazenyl-1H-indol-2-ol |
| InChIKey | NRRBDRCZCPYBBY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=C(N2)O)N=N)Cl)Cl |
Computed by PubChem (NCBI)