Products 352535-85-4
CAS 352535-85-4 appears in our catalog under these names: 2-Chloro-6-fluoro-3-methylphenylboronic acid, 95%, 2-Chloro-6-fluoro-3-methylphenylboronic acid, 98%, 2-Chloro-6-fluoro-3-methylphenylboronic acid, 97%. Offered by: AmBeed, Fluorochem, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg, 50g, 100g.
(2-chloro-6-fluoro-3-methylphenyl)boronic acid (CAS 352535-85-4) is a chemical compound with the molecular formula C7H7BClFO2 and a molecular weight of 188.39 g/mol. IUPAC name: (2-chloro-6-fluoro-3-methylphenyl)boronic acid. InChIKey: FOZVMQJCNIKFOB-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO2 |
|---|---|
| Molecular weight | 188.39 g/mol |
| IUPAC name | (2-chloro-6-fluoro-3-methylphenyl)boronic acid |
| InChIKey | FOZVMQJCNIKFOB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1Cl)C)F)(O)O |
Computed by PubChem (NCBI)