Products 352535-86-5
CAS 352535-86-5 is the registry number for 2-Chloro-6-fluoro-5-methylphenylboronic acid, 97%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 5g, 10g, 25g, 1g.
(6-chloro-2-fluoro-3-methylphenyl)boronic acid (CAS 352535-86-5) is a chemical compound with the molecular formula C7H7BClFO2 and a molecular weight of 188.39 g/mol. IUPAC name: (6-chloro-2-fluoro-3-methylphenyl)boronic acid. InChIKey: OXBULPFGOYOICC-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO2 |
|---|---|
| Molecular weight | 188.39 g/mol |
| IUPAC name | (6-chloro-2-fluoro-3-methylphenyl)boronic acid |
| InChIKey | OXBULPFGOYOICC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)C)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Chloro-6-fluoro-5-methylphenylboronic acid, (6-chloro-2-fluoro-3-methylphenyl)boronic acid, 2-Fluoro-3-methyl-6-chlorophenylboronic acid, 6-chloro-2-fluoro-3-methylphenylboronic acid, 2-Chloro-6-fluoro-5-methylphenylboronicacid, (6-chloro-2-fluoro-3-methyl-phenyl)boronic Acid, OXBULPFGOYOICC-UHFFFAOYSA-N, 557269_ALDRICH, 2-Chloro-6-fluoro-5-methylphenylboronic acid, 352535-86-5