CAS 355810-48-9 is the registry number for 5-(Benzo[d][1,3]dioxol-5-ylamino)-5-oxopentanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(1,3-benzodioxol-5-ylamino)-5-oxopentanoic acid (CAS 355810-48-9) is a chemical compound with the molecular formula C12H13NO5 and a molecular weight of 251.23 g/mol. IUPAC name: 5-(1,3-benzodioxol-5-ylamino)-5-oxopentanoic acid. InChIKey: YGFNTNYDYCLKCD-UHFFFAOYSA-N.
| Molecular formula | C12H13NO5 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | 5-(1,3-benzodioxol-5-ylamino)-5-oxopentanoic acid |
| InChIKey | YGFNTNYDYCLKCD-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)NC(=O)CCCC(=O)O |
Computed by PubChem (NCBI)