Products 355810-48-9

CAS 355810-48-9 is the registry number for 5-(Benzo[d][1,3]dioxol-5-ylamino)-5-oxopentanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-(1,3-benzodioxol-5-ylamino)-5-oxopentanoic acid (CAS 355810-48-9) is a chemical compound with the molecular formula C12H13NO5 and a molecular weight of 251.23 g/mol. IUPAC name: 5-(1,3-benzodioxol-5-ylamino)-5-oxopentanoic acid. InChIKey: YGFNTNYDYCLKCD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13NO5
Molecular weight251.23 g/mol
IUPAC name5-(1,3-benzodioxol-5-ylamino)-5-oxopentanoic acid
InChIKeyYGFNTNYDYCLKCD-UHFFFAOYSA-N
SMILESC1OC2=C(O1)C=C(C=C2)NC(=O)CCCC(=O)O

Computed by PubChem (NCBI)