Products 35645-98-8
CAS 35645-98-8 appears in our catalog under these names: 2-(2-hydroxy-2-phenylethyl)-1H-isoindole-1,3(2H)-dione, 95%, 95%, 2-(2-Hydroxy-2-phenylethyl)isoindoline-1,3-dione, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-(2-hydroxy-2-phenylethyl)isoindole-1,3-dione (CAS 35645-98-8) is a chemical compound with the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. IUPAC name: 2-(2-hydroxy-2-phenylethyl)isoindole-1,3-dione. InChIKey: ZVLMFDLMBNOUJG-UHFFFAOYSA-N.
| Molecular formula | C16H13NO3 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | 2-(2-hydroxy-2-phenylethyl)isoindole-1,3-dione |
| InChIKey | ZVLMFDLMBNOUJG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CN2C(=O)C3=CC=CC=C3C2=O)O |
Computed by PubChem (NCBI)