CAS 35761-15-0 appears in our catalog under these names: (3S)-3,6-Diaminohexanoic acid dihydrochloride, 95%, 95%, (3S)-3,6-DIAMINOHEXANOIC ACID DIHYDROCHLORIDE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(3S)-3,6-diaminohexanoic acid;dihydrochloride (CAS 35761-15-0) is a chemical compound with the molecular formula C6H16Cl2N2O2 and a molecular weight of 219.11 g/mol. IUPAC name: (3S)-3,6-diaminohexanoic acid;dihydrochloride. InChIKey: ATIYVUIIEUEADI-XRIGFGBMSA-N.
| Molecular formula | C6H16Cl2N2O2 |
|---|---|
| Molecular weight | 219.11 g/mol |
| IUPAC name | (3S)-3,6-diaminohexanoic acid;dihydrochloride |
| InChIKey | ATIYVUIIEUEADI-XRIGFGBMSA-N |
| SMILES | C(C[C@@H](CC(=O)O)N)CN.Cl.Cl |
Computed by PubChem (NCBI)