Products 35886-80-7
CAS 35886-80-7 appears in our catalog under these names: Ac-Ser(Bzl)-OH, 97%, (S)-2-Acetamido-3-(benzyloxy)propanoic acid, 98%, Ac–Ser(Bzl)–OH, Acetyl-O-benzyl-L-serine, 99%. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem. Available pack sizes: 25g, 1g, 5g.
(2S)-2-acetamido-3-phenylmethoxypropanoic acid (CAS 35886-80-7) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: (2S)-2-acetamido-3-phenylmethoxypropanoic acid. InChIKey: TVFIOVJIUUWDCR-NSHDSACASA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (2S)-2-acetamido-3-phenylmethoxypropanoic acid |
| InChIKey | TVFIOVJIUUWDCR-NSHDSACASA-N |
| SMILES | CC(=O)N[C@@H](COCC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)