CAS 359828-68-5 appears in our catalog under these names: 2-(2,6-Difluorophenyl)propanoic acid, 95%, 2-(2,6-Difluorophenyl)propanoic acid, 98+%, 2-(2,6-Difluorophenyl)propanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 10g, 5g, 0,5g, 50mg.
2-(2,6-difluorophenyl)propanoic acid (CAS 359828-68-5) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: 2-(2,6-difluorophenyl)propanoic acid. InChIKey: JEOKHTAAVBOFKM-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | 2-(2,6-difluorophenyl)propanoic acid |
| InChIKey | JEOKHTAAVBOFKM-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=CC=C1F)F)C(=O)O |
Computed by PubChem (NCBI)