Products 36112-61-5
CAS 36112-61-5 appears in our catalog under these names: 6-Methoxy-1-naphthoic acid, 95%, 6-Methoxy-1-naphthoic acid, 97%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg.
6-methoxynaphthalene-1-carboxylic acid (CAS 36112-61-5) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: 6-methoxynaphthalene-1-carboxylic acid. InChIKey: WRZAWKSSADRYTA-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 6-methoxynaphthalene-1-carboxylic acid |
| InChIKey | WRZAWKSSADRYTA-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)