CAS 36363-18-5 is the registry number for 4-Nitro-2-(nitromethyl)phenol. Offered by: TRC. Available pack sizes: 1g.
4-nitro-2-(nitromethyl)phenol (CAS 36363-18-5) is a chemical compound with the molecular formula C7H6N2O5 and a molecular weight of 198.13 g/mol. IUPAC name: 4-nitro-2-(nitromethyl)phenol. InChIKey: YFJPYPAXKKYZFZ-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O5 |
|---|---|
| Molecular weight | 198.13 g/mol |
| IUPAC name | 4-nitro-2-(nitromethyl)phenol |
| InChIKey | YFJPYPAXKKYZFZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C[N+](=O)[O-])O |
Computed by PubChem (NCBI)