Products 366-56-3
CAS 366-56-3 appears in our catalog under these names: 2-(2,5-Difluorophenoxy)acetic acid, 95%, 2–(2，5–Difluorophenoxy)acetic acid, 2-(2,5-Difluorophenoxy)acetic acid. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 10g, 250mg, 1g, 5g, 100mg.
2-(2,5-difluorophenoxy)acetic acid (CAS 366-56-3) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: 2-(2,5-difluorophenoxy)acetic acid. InChIKey: NLVMDNXMYYNPTJ-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 2-(2,5-difluorophenoxy)acetic acid |
| InChIKey | NLVMDNXMYYNPTJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)OCC(=O)O)F |
Computed by PubChem (NCBI)