CAS 3669-47-4 appears in our catalog under these names: 1,2–Bis(4–hydroxyphenyl)ethanone, 1,2-Bis(4-hydroxyphenyl)ethanone 98%, 1,2-BIS(4-HYDROXYPHENYL)ETHANONE, 98%+, 1,2-Bis(4-Hydroxyphenyl)Ethanone, 98%+, 98%+. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g.
1,2-bis(4-hydroxyphenyl)ethanone (CAS 3669-47-4) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 1,2-bis(4-hydroxyphenyl)ethanone. InChIKey: HZPYKPXLYFNHFD-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 1,2-bis(4-hydroxyphenyl)ethanone |
| InChIKey | HZPYKPXLYFNHFD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)C2=CC=C(C=C2)O)O |
Computed by PubChem (NCBI)