CAS 367501-31-3 is the registry number for 4-Amino-3-ethoxybenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-amino-3-ethoxybenzoic acid (CAS 367501-31-3) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 4-amino-3-ethoxybenzoic acid. InChIKey: ZSXBMWHEQHCCRP-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 4-amino-3-ethoxybenzoic acid |
| InChIKey | ZSXBMWHEQHCCRP-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)C(=O)O)N |
Computed by PubChem (NCBI)