Products 36790-43-9
CAS 36790-43-9 is the registry number for Frutescin - Chrysanthemum segetum (corn marigold). Offered by: Biosynth. Available pack sizes: 2mg, 5mg, 10mg, 25mg.
(3aR,5Z,9E,11aS)-6-methyl-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-10-carbaldehyde (CAS 36790-43-9) is a chemical compound with the molecular formula C15H18O3 and a molecular weight of 246.30 g/mol. IUPAC name: (3aR,5Z,9E,11aS)-6-methyl-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-10-carbaldehyde. InChIKey: OXOKNXVZMNZEGP-XQPVGIKBSA-N.
| Molecular formula | C15H18O3 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | (3aR,5Z,9E,11aS)-6-methyl-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-10-carbaldehyde |
| InChIKey | OXOKNXVZMNZEGP-XQPVGIKBSA-N |
| SMILES | C/C/1=C/C[C@H]2[C@H](C/C(=C\CC1)/C=O)OC(=O)C2=C |
Computed by PubChem (NCBI)