CAS 370-58-1 is the registry number for (3,4-Difluorophenoxy)acetic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.
2-(3,4-difluorophenoxy)acetic acid (CAS 370-58-1) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: 2-(3,4-difluorophenoxy)acetic acid. InChIKey: TXHHUINCRBZJDL-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 2-(3,4-difluorophenoxy)acetic acid |
| InChIKey | TXHHUINCRBZJDL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OCC(=O)O)F)F |
Computed by PubChem (NCBI)