Products 3705-21-3
CAS 3705-21-3 appears in our catalog under these names: 5–Hydroxy–1H–indole–3–carboxylic acid, 1H-Indole-3-carboxylic acid, 5-hydroxy-, 5-Hydroxy-1H-indole-3-carboxylic acid 97%, 5-Hydroxy-1H-indole-3-carboxylic acid, 98%, 5-Hydroxy-1H-indole-3-carboxylic acid, 97%, 97%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 0,5g, 5g, 1g.
5-hydroxy-1H-indole-3-carboxylic acid (CAS 3705-21-3) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 5-hydroxy-1H-indole-3-carboxylic acid. InChIKey: RVWZUOPFHTYIEO-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 5-hydroxy-1H-indole-3-carboxylic acid |
| InChIKey | RVWZUOPFHTYIEO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C(=CN2)C(=O)O |
Computed by PubChem (NCBI)