CAS 3709-16-8 is the registry number for 2-phenyl-1,3-dioxane-4,6-dione. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.
2-phenyl-1,3-dioxane-4,6-dione (CAS 3709-16-8) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: 2-phenyl-1,3-dioxane-4,6-dione. InChIKey: ISDGWTZFJKFKMO-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 2-phenyl-1,3-dioxane-4,6-dione |
| InChIKey | ISDGWTZFJKFKMO-UHFFFAOYSA-N |
| SMILES | C1C(=O)OC(OC1=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)