CAS 373603-19-1 appears in our catalog under these names: 1-(2,4-Difluoro-3-methoxyphenyl)ethanone, 97%, 2',4'-Difluoro-3'-methoxyacetophenone, 95%, 2,4-Difluoro-3-methoxy acetophenone, 99%(GC-MS),RG, 99%(GC-MS),RG, 2',4'-Difluoro-3'-methoxyacetophenone, 99%(GC-MS),RG. Offered by: AmBeed, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 25g, 250mg, 5g, 1g.
1-(2,4-difluoro-3-methoxyphenyl)ethanone (CAS 373603-19-1) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: 1-(2,4-difluoro-3-methoxyphenyl)ethanone. InChIKey: KTZOZLGEZVDGMS-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | 1-(2,4-difluoro-3-methoxyphenyl)ethanone |
| InChIKey | KTZOZLGEZVDGMS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C=C1)F)OC)F |
Computed by PubChem (NCBI)