CAS 374064-01-4 appears in our catalog under these names: 3–(Pyridin–3–yl)–1H–pyrazole–5–carboxylic acid, 3-(Pyridin-3-yl)-1H-pyrazole-5-carboxylic acid, 97%, 97%, 5-Pyridin-3-yl-1H-pyrazole-3-carboxylic acid, 95%, 3-(Pyridin-3-yl)-1H-pyrazole-5-carboxylic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g.
3-pyridin-3-yl-1H-pyrazole-5-carboxylic acid (CAS 374064-01-4) is a chemical compound with the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. IUPAC name: 3-pyridin-3-yl-1H-pyrazole-5-carboxylic acid. InChIKey: VZCDZCUPZRFWAW-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 3-pyridin-3-yl-1H-pyrazole-5-carboxylic acid |
| InChIKey | VZCDZCUPZRFWAW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NNC(=C2)C(=O)O |
Computed by PubChem (NCBI)