CAS 37498-95-6 appears in our catalog under these names: (R)-4-Benzyloxazolidine-2,5-dione, 97%, 97%, (R)-4-Benzyl-oxazolidine-2,5-dione, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
(4R)-4-benzyl-1,3-oxazolidine-2,5-dione (CAS 37498-95-6) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: (4R)-4-benzyl-1,3-oxazolidine-2,5-dione. InChIKey: GQBIVYSGPXCELZ-MRVPVSSYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | (4R)-4-benzyl-1,3-oxazolidine-2,5-dione |
| InChIKey | GQBIVYSGPXCELZ-MRVPVSSYSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H]2C(=O)OC(=O)N2 |
Computed by PubChem (NCBI)