CAS 583-47-1 appears in our catalog under these names: 4-Benzyloxazolidine-2,5-dione, 4–Benzyloxazolidine–2,5–dione, 4-Benzyloxazolidine-2,5-dione, 95%, 95%, 4-Benzyloxazolidine-2,5-dione, 98%. Offered by: TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 500mg, 50mg, 1g, 200mg, 5g, 250mg, 10g.
4-benzyl-1,3-oxazolidine-2,5-dione (CAS 583-47-1) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 4-benzyl-1,3-oxazolidine-2,5-dione. InChIKey: GQBIVYSGPXCELZ-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 4-benzyl-1,3-oxazolidine-2,5-dione |
| InChIKey | GQBIVYSGPXCELZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2C(=O)OC(=O)N2 |
Computed by PubChem (NCBI)