Products 37674-72-9
CAS 37674-72-9 appears in our catalog under these names: 6–Chloro–4–chromanone, 6-Chloro-4-chromanone, >98.0%(GC), 6-Chlorochroman-4-one 97%, 6-Chlorochroman-4-one, 98%, 98%, 6-Chlorochroman-4-one, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 250mg, 1g, 10g, 250g, 50g.
6-chloro-2,3-dihydrochromen-4-one (CAS 37674-72-9) is a chemical compound with the molecular formula C9H7ClO2 and a molecular weight of 182.60 g/mol. IUPAC name: 6-chloro-2,3-dihydrochromen-4-one. InChIKey: LLTDYHFVIVSQPJ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO2 |
|---|---|
| Molecular weight | 182.60 g/mol |
| IUPAC name | 6-chloro-2,3-dihydrochromen-4-one |
| InChIKey | LLTDYHFVIVSQPJ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C=C(C=C2)Cl |
Computed by PubChem (NCBI)
Synonyms:
6-Chlorochroman-4-one, 6-Chloro-4-chromanone, 6-chloro-2,3-dihydrochromen-4-one, 6-Chloro chroman-4-one, 4H-1-Benzopyran-4-one, 6-chloro-2,3-dihydro-, 6-chloro-chroman-4-one, 4-Chromanone, 6-chloro-, 6-Chloro-4-chromanone, 97%, 6-Chloro-2,3-dihydro-4H-chromen-4-one, 6-Chloro-2,3-dihydro-4H-chromen-4-one #