Products 377734-27-5
CAS 377734-27-5 appears in our catalog under these names: Methyl 3–Bromo–5–formylbenzoate, methyl 3-bromo-5-formylbenzoate, Methyl 3-bromo-5-formylbenzoate 98%, Methyl 3-bromo-5-formylbenzoate, 95%, Methyl 3-bromo-5-formylbenzoate, 95-<97%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, Hoffman Fine Chemicals. Available pack sizes: 1g, 250mg, 0,5g, 5g, 100mg, 10g, 25g, 50g.
Methyl 3-bromo-5-formylbenzoate (CAS 377734-27-5) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: methyl 3-bromo-5-formylbenzoate. InChIKey: GFZITIUEBBDMMN-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | methyl 3-bromo-5-formylbenzoate |
| InChIKey | GFZITIUEBBDMMN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C=O)Br |
Computed by PubChem (NCBI)