CAS 37795-77-0 appears in our catalog under these names: 5-Methoxyisatoic Anhydride, 6-Methoxy-1H-benzo[d][1,3]oxazine-2,4-dione 97%, 2H-3,1-Benzoxazine-2,4(1H)-dione, 6-methoxy-, 98%, 98%, 5-Methoxy-isatoic anhydride, 97%, 6-Methoxy-1H-benzo[d][1,3]oxazine-2,4-dione, 98%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 1g, 5g, 25g, 100mg.
6-methoxy-1H-3,1-benzoxazine-2,4-dione (CAS 37795-77-0) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 6-methoxy-1H-3,1-benzoxazine-2,4-dione. InChIKey: JFAFNQOODJCVGT-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 6-methoxy-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | JFAFNQOODJCVGT-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC(=O)OC2=O |
Computed by PubChem (NCBI)