CAS 379228-57-6 appears in our catalog under these names: Methyl 2–amino–4,6–difluorobenzoate, Methyl 2-Amino-4,6-difluorobenzoate, 98%, 98%, Methyl 2-amino-4,6-difluorobenzoate, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
Methyl 2-amino-4,6-difluorobenzoate (CAS 379228-57-6) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: methyl 2-amino-4,6-difluorobenzoate. InChIKey: SECMISFZCMBTKJ-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | methyl 2-amino-4,6-difluorobenzoate |
| InChIKey | SECMISFZCMBTKJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1F)F)N |
Computed by PubChem (NCBI)