Products 380576-92-1
CAS 380576-92-1 is the registry number for Ethyl 2-amino-1-(4-methoxyphenyl)-5-oxo-4,5-dihydro-1H-pyrrole-3-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Ethyl 5-amino-1-(4-methoxyphenyl)-2-oxo-3H-pyrrole-4-carboxylate (CAS 380576-92-1) is a chemical compound with the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. IUPAC name: ethyl 5-amino-1-(4-methoxyphenyl)-2-oxo-3H-pyrrole-4-carboxylate. InChIKey: KGAKKSIYQPGMQY-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O4 |
|---|---|
| Molecular weight | 276.29 g/mol |
| IUPAC name | ethyl 5-amino-1-(4-methoxyphenyl)-2-oxo-3H-pyrrole-4-carboxylate |
| InChIKey | KGAKKSIYQPGMQY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C(=O)C1)C2=CC=C(C=C2)OC)N |
Computed by PubChem (NCBI)