CAS 38059-73-3 appears in our catalog under these names: Prucalopride Impurity 62, Mesalamine Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-acetamido-2-acetyloxybenzoate (CAS 38059-73-3) is a chemical compound with the molecular formula C12H13NO5 and a molecular weight of 251.23 g/mol. IUPAC name: methyl 4-acetamido-2-acetyloxybenzoate. InChIKey: STQLRWBYYGWCCY-UHFFFAOYSA-N.
| Molecular formula | C12H13NO5 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | methyl 4-acetamido-2-acetyloxybenzoate |
| InChIKey | STQLRWBYYGWCCY-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1)C(=O)OC)OC(=O)C |
Computed by PubChem (NCBI)